C24H23N3O2 — CID 72721233
(9-benzylpyrido[3,4-b]indol-3-yl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 72721233) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (9-benzylpyrido[3,4-b]indol-3-yl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (9-benzylpyrido[3,4-b]indol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 72721233 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (9-benzylpyrido[3,4-b]indol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2c3ccccc3n(Cc3ccccc3)c2cn1)N1CCC(O)CC1 |
| InChI | InChI=1S/C24H23N3O2/c28-18-10-12-26(13-11-18)24(29)21-14-20-19-8-4-5-9-22(19)27(23(20)15-25-21)16-17-6-2-1-3-7-17/h1-9,14-15,18,28H,10-13,16H2 |
| InChIKey | BJLSQKMKFSDOEX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |