C21H22N2O2 — CID 110883917
(1-benzylindol-3-yl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 110883917) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (1-benzylindol-3-yl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (1-benzylindol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110883917 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1-benzylindol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)c2ccccc12)N1CCC(O)CC1 |
| InChI | InChI=1S/C21H22N2O2/c24-17-10-12-22(13-11-17)21(25)19-15-23(14-16-6-2-1-3-7-16)20-9-5-4-8-18(19)20/h1-9,15,17,24H,10-14H2 |
| InChIKey | PDQOCRDBKMXIGZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |