C29H27ClN2O2 — CID 110173436
1-(4-benzylpiperidin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione (PubChem CID 110173436) has the molecular formula C29H27ClN2O2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 110173436 |
| Molecular Formula | C29H27ClN2O2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(Cc2ccccc2)CC1)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H27ClN2O2/c30-24-12-10-23(11-13-24)19-32-20-26(25-8-4-5-9-27(25)32)28(33)29(34)31-16-14-22(15-17-31)18-21-6-2-1-3-7-21/h1-13,20,22H,14-19H2 |
| InChIKey | GLQYMWLRAHKNJT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|