C34H30ClN3O2 — CID 110173158
1-(4-benzhydrylpiperazin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione (PubChem CID 110173158) has the molecular formula C34H30ClN3O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 110173158 |
| Molecular Formula | C34H30ClN3O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C34H30ClN3O2/c35-28-17-15-25(16-18-28)23-38-24-30(29-13-7-8-14-31(29)38)33(39)34(40)37-21-19-36(20-22-37)32(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-18,24,32H,19-23H2 |
| InChIKey | NYHOFOZOJPVBQZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|