C25H26ClN3O — CID 92767870
N-benzyl-4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carboxamide (PubChem CID 92767870) has the molecular formula C25H26ClN3O and a molecular weight of 419.96 g/mol. Its IUPAC name is N-benzyl-4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 92767870 |
| Molecular Formula | C25H26ClN3O |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-benzyl-4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O/c26-23-13-11-22(12-14-23)24(21-9-5-2-6-10-21)28-15-17-29(18-16-28)25(30)27-19-20-7-3-1-4-8-20/h1-14,24H,15-19H2,(H,27,30)/t24-/m1/s1 |
| InChIKey | GJQFKMCUZYDDCW-XMMPIXPASA-N |
| XLogP | 4.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |