C23H28ClN3O — CID 46100874
4-[(4-chlorophenyl)-phenylmethyl]-N-cyclopentylpiperazine-1-carboxamide (PubChem CID 46100874) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-phenylmethyl]-N-cyclopentylpiperazine-1-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)-phenylmethyl]-N-cyclopentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 46100874 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-[(4-chlorophenyl)-phenylmethyl]-N-cyclopentylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O/c24-20-12-10-19(11-13-20)22(18-6-2-1-3-7-18)26-14-16-27(17-15-26)23(28)25-21-8-4-5-9-21/h1-3,6-7,10-13,21-22H,4-5,8-9,14-17H2,(H,25,28) |
| InChIKey | UFMCCXBCCVGNNZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |