C22H34N4O2 — CID 112818881
N-cyclohexyl-4-[1-oxo-1-(1-phenylethylamino)propan-2-yl]piperazine-1-carboxamide (PubChem CID 112818881) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[1-oxo-1-(1-phenylethylamino)propan-2-yl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[1-oxo-1-(1-phenylethylamino)propan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112818881 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N-cyclohexyl-4-[1-oxo-1-(1-phenylethylamino)propan-2-yl]piperazine-1-carboxamide |
| SMILES | CC(NC(=O)C(C)N1CCN(C(=O)NC2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H34N4O2/c1-17(19-9-5-3-6-10-19)23-21(27)18(2)25-13-15-26(16-14-25)22(28)24-20-11-7-4-8-12-20/h3,5-6,9-10,17-18,20H,4,7-8,11-16H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | IXSCKWYQRZKAMF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |