C17H28ClN3O — CID 119920377
2-[3-(methylamino)piperidin-1-yl]-N-(1-phenylethyl)propanamide;hydrochloride (PubChem CID 119920377) has the molecular formula C17H28ClN3O and a molecular weight of 325.88 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-(1-phenylethyl)propanamide;hydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-(1-phenylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119920377 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-(1-phenylethyl)propanamide;hydrochloride |
| SMILES | CNC1CCCN(C(C)C(=O)NC(C)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H27N3O.ClH/c1-13(15-8-5-4-6-9-15)19-17(21)14(2)20-11-7-10-16(12-20)18-3;/h4-6,8-9,13-14,16,18H,7,10-12H2,1-3H3,(H,19,21);1H |
| InChIKey | KAPKTKRGXQRDMS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |