C17H27ClN4O2 — CID 119918549
N-(benzylcarbamoyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride (PubChem CID 119918549) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride.
| Compound Name | N-(benzylcarbamoyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119918549 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride |
| SMILES | CNC1CCCN(C(C)C(=O)NC(=O)NCc2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H26N4O2.ClH/c1-13(21-10-6-9-15(12-21)18-2)16(22)20-17(23)19-11-14-7-4-3-5-8-14;/h3-5,7-8,13,15,18H,6,9-12H2,1-2H3,(H2,19,20,22,23);1H |
| InChIKey | HZOZFSYTAXGAOQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |