C23H30N4O2 — CID 9460175
(2R)-N-(benzylcarbamoyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanamide (PubChem CID 9460175) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2R)-N-(benzylcarbamoyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(benzylcarbamoyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9460175 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (2R)-N-(benzylcarbamoyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanamide |
| SMILES | Cc1cccc(N2CCN([C@H](C)C(=O)NC(=O)NCc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C23H30N4O2/c1-17-8-7-11-21(18(17)2)27-14-12-26(13-15-27)19(3)22(28)25-23(29)24-16-20-9-5-4-6-10-20/h4-11,19H,12-16H2,1-3H3,(H2,24,25,28,29)/t19-/m1/s1 |
| InChIKey | RYWJFSRYRWBUMV-LJQANCHMSA-N |
| XLogP | 2.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |