C18H27N3O — CID 9460029
(2R)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-prop-2-enylpropanamide (PubChem CID 9460029) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (2R)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 9460029 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (2R)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C18H27N3O/c1-5-9-19-18(22)16(4)20-10-12-21(13-11-20)17-8-6-7-14(2)15(17)3/h5-8,16H,1,9-13H2,2-4H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | YCDAKAYJRBJZNQ-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|