C16H24N4O2 — CID 18086306
N-(methylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide (PubChem CID 18086306) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(methylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 18086306 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-(methylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-12-6-4-5-7-14(12)20-10-8-19(9-11-20)13(2)15(21)18-16(22)17-3/h4-7,13H,8-11H2,1-3H3,(H2,17,18,21,22) |
| InChIKey | NPNOUMLDGARUNS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |