C20H32N4O — CID 92987492
(2S)-2-[4-(2-methylphenyl)piperazin-1-yl]-N-(2-pyrrolidin-1-ylethyl)propanamide (PubChem CID 92987492) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is (2S)-2-[4-(2-methylphenyl)piperazin-1-yl]-N-(2-pyrrolidin-1-ylethyl)propanamide.
| Compound Name | (2S)-2-[4-(2-methylphenyl)piperazin-1-yl]-N-(2-pyrrolidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 92987492 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (2S)-2-[4-(2-methylphenyl)piperazin-1-yl]-N-(2-pyrrolidin-1-ylethyl)propanamide |
| SMILES | Cc1ccccc1N1CCN([C@@H](C)C(=O)NCCN2CCCC2)CC1 |
| InChI | InChI=1S/C20H32N4O/c1-17-7-3-4-8-19(17)24-15-13-23(14-16-24)18(2)20(25)21-9-12-22-10-5-6-11-22/h3-4,7-8,18H,5-6,9-16H2,1-2H3,(H,21,25)/t18-/m0/s1 |
| InChIKey | HKEGVNFNJHWECQ-SFHVURJKSA-N |
| XLogP | 1.72 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |