C21H34N4O2 — CID 119919543
2-[3-(methylamino)piperidin-1-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]propanamide (PubChem CID 119919543) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 119919543 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]propanamide |
| SMILES | CNC1CCCN(C(C)C(=O)NCc2ccc(CN3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C21H34N4O2/c1-17(25-9-3-4-20(16-25)22-2)21(26)23-14-18-5-7-19(8-6-18)15-24-10-12-27-13-11-24/h5-8,17,20,22H,3-4,9-16H2,1-2H3,(H,23,26) |
| InChIKey | IOYDHMINKBWFBC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |