C20H28N2O4 — CID 136550801
4-[[2-(6-cyclobutyl-1,4-oxazepan-4-yl)propanoylamino]methyl]benzoic acid (PubChem CID 136550801) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-[[2-(6-cyclobutyl-1,4-oxazepan-4-yl)propanoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(6-cyclobutyl-1,4-oxazepan-4-yl)propanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 136550801 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-[[2-(6-cyclobutyl-1,4-oxazepan-4-yl)propanoylamino]methyl]benzoic acid |
| SMILES | CC(C(=O)NCc1ccc(C(=O)O)cc1)N1CCOCC(C2CCC2)C1 |
| InChI | InChI=1S/C20H28N2O4/c1-14(22-9-10-26-13-18(12-22)16-3-2-4-16)19(23)21-11-15-5-7-17(8-6-15)20(24)25/h5-8,14,16,18H,2-4,9-13H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | BYNBLBTXIXMZTB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |