C21H29N3O5 — CID 55486707
methyl 4-[[2-[4-(oxolane-2-carbonyl)piperazin-1-yl]propanoylamino]methyl]benzoate (PubChem CID 55486707) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 4-[[2-[4-(oxolane-2-carbonyl)piperazin-1-yl]propanoylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[4-(oxolane-2-carbonyl)piperazin-1-yl]propanoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 55486707 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | methyl 4-[[2-[4-(oxolane-2-carbonyl)piperazin-1-yl]propanoylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C(C)N2CCN(C(=O)C3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O5/c1-15(19(25)22-14-16-5-7-17(8-6-16)21(27)28-2)23-9-11-24(12-10-23)20(26)18-4-3-13-29-18/h5-8,15,18H,3-4,9-14H2,1-2H3,(H,22,25) |
| InChIKey | QJTQGYMNMVVULP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |