C18H25N3O3S — CID 3309593
N-[(4-methoxyphenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 3309593) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3309593 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(CNC(=S)N2CCN(C(=O)C3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-23-15-6-4-14(5-7-15)13-19-18(25)21-10-8-20(9-11-21)17(22)16-3-2-12-24-16/h4-7,16H,2-3,8-13H2,1H3,(H,19,25) |
| InChIKey | JXEYOQQEDXSMSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|