C24H31ClN4O — CID 56682756
4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]-N-cyclohexylpiperidine-1-carboxamide (PubChem CID 56682756) has the molecular formula C24H31ClN4O and a molecular weight of 426.99 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]-N-cyclohexylpiperidine-1-carboxamide.
| Compound Name | 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]-N-cyclohexylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 56682756 |
| Molecular Formula | C24H31ClN4O |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]-N-cyclohexylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCC(NC(c2ccc(Cl)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C24H31ClN4O/c25-20-10-8-18(9-11-20)23(19-5-4-14-26-17-19)27-22-12-15-29(16-13-22)24(30)28-21-6-2-1-3-7-21/h4-5,8-11,14,17,21-23,27H,1-3,6-7,12-13,15-16H2,(H,28,30) |
| InChIKey | HDBLROBNWPJKMF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |