C22H22ClN5O — CID 51589039
N-[(S)-(4-chlorophenyl)-pyridin-3-ylmethyl]-2-piperidin-1-ylpyrimidine-5-carboxamide (PubChem CID 51589039) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is N-[(S)-(4-chlorophenyl)-pyridin-3-ylmethyl]-2-piperidin-1-ylpyrimidine-5-carboxamide.
| Compound Name | N-[(S)-(4-chlorophenyl)-pyridin-3-ylmethyl]-2-piperidin-1-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 51589039 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[(S)-(4-chlorophenyl)-pyridin-3-ylmethyl]-2-piperidin-1-ylpyrimidine-5-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(Cl)cc1)c1cccnc1)c1cnc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C22H22ClN5O/c23-19-8-6-16(7-9-19)20(17-5-4-10-24-13-17)27-21(29)18-14-25-22(26-15-18)28-11-2-1-3-12-28/h4-10,13-15,20H,1-3,11-12H2,(H,27,29)/t20-/m0/s1 |
| InChIKey | ZYYRKNCMADTGNX-FQEVSTJZSA-N |
| XLogP | 4.03 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |