C23H22Cl2FN3 — CID 56672780
1-(4-chloro-2-fluorophenyl)-N-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-amine (PubChem CID 56672780) has the molecular formula C23H22Cl2FN3 and a molecular weight of 430.35 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-amine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 56672780 |
| Molecular Formula | C23H22Cl2FN3 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-amine |
| SMILES | Fc1cc(Cl)ccc1N1CCC(NC(c2ccc(Cl)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C23H22Cl2FN3/c24-18-5-3-16(4-6-18)23(17-2-1-11-27-15-17)28-20-9-12-29(13-10-20)22-8-7-19(25)14-21(22)26/h1-8,11,14-15,20,23,28H,9-10,12-13H2 |
| InChIKey | JLLMEXHLPNTIKG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |