C24H24ClN3O2 — CID 56682752
phenyl 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]piperidine-1-carboxylate (PubChem CID 56682752) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is phenyl 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]piperidine-1-carboxylate.
| Compound Name | phenyl 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56682752 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | phenyl 4-[[(4-chlorophenyl)-pyridin-3-ylmethyl]amino]piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCC(NC(c2ccc(Cl)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-20-10-8-18(9-11-20)23(19-5-4-14-26-17-19)27-21-12-15-28(16-13-21)24(29)30-22-6-2-1-3-7-22/h1-11,14,17,21,23,27H,12-13,15-16H2 |
| InChIKey | ZNJPHSGUPUIDCS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |