C26H38N2O3 — CID 142651449
phenyl 4-[(2,2-dicyclohexylacetyl)amino]piperidine-1-carboxylate (PubChem CID 142651449) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is phenyl 4-[(2,2-dicyclohexylacetyl)amino]piperidine-1-carboxylate.
| Compound Name | phenyl 4-[(2,2-dicyclohexylacetyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142651449 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | phenyl 4-[(2,2-dicyclohexylacetyl)amino]piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)Oc2ccccc2)CC1)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H38N2O3/c29-25(24(20-10-4-1-5-11-20)21-12-6-2-7-13-21)27-22-16-18-28(19-17-22)26(30)31-23-14-8-3-9-15-23/h3,8-9,14-15,20-22,24H,1-2,4-7,10-13,16-19H2,(H,27,29) |
| InChIKey | FWUCXQMQPYDEIE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |