C19H20N2O3S — CID 108565830
phenyl N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]carbamate (PubChem CID 108565830) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is phenyl N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]carbamate.
| Compound Name | phenyl N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108565830 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | phenyl N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]carbamate |
| SMILES | O=C(NC1CCN(C(=O)c2ccccc2S)CC1)Oc1ccccc1 |
| InChI | InChI=1S/C19H20N2O3S/c22-18(16-8-4-5-9-17(16)25)21-12-10-14(11-13-21)20-19(23)24-15-6-2-1-3-7-15/h1-9,14,25H,10-13H2,(H,20,23) |
| InChIKey | AKPWCJCUIOEKCZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|