About benzene;phenyl N-cyclopropylcarbamate
benzene;phenyl N-cyclopropylcarbamate (PubChem CID 171499901) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is benzene;phenyl N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | benzene;phenyl N-cyclopropylcarbamate |
| PubChem CID | 171499901 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | benzene;phenyl N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)Oc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C10H11NO2.C6H6/c12-10(11-8-6-7-8)13-9-4-2-1-3-5-9;1-2-4-6-5-3-1/h1-5,8H,6-7H2,(H,11,12);1-6H |
| InChIKey | MQULDDKQCUQFNI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;phenyl N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;phenyl N-cyclopropylcarbamate?
The IUPAC name of benzene;phenyl N-cyclopropylcarbamate (CID 171499901) is benzene;phenyl N-cyclopropylcarbamate.
What is the SMILES notation for benzene;phenyl N-cyclopropylcarbamate?
The canonical SMILES for benzene;phenyl N-cyclopropylcarbamate is O=C(NC1CC1)Oc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;phenyl N-cyclopropylcarbamate?
The InChIKey is MQULDDKQCUQFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C6H6/c12-10(11-8-6-7-8)13-9-4-2-1-3-5-9;1-2-4-6-5-3-1/h1-5,8H,6-7H2,(H,11,12);1-6H.
What are the key properties of benzene;phenyl N-cyclopropylcarbamate?
benzene;phenyl N-cyclopropylcarbamate has a molecular weight of 255.32 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;phenyl N-cyclopropylcarbamate is sourced from PubChem (CID 171499901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).