About phenyl N-cyclopentylcarbamate
phenyl N-cyclopentylcarbamate (PubChem CID 12791466) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is phenyl N-cyclopentylcarbamate.
Molecular Properties
| Compound Name | phenyl N-cyclopentylcarbamate |
| PubChem CID | 12791466 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | phenyl N-cyclopentylcarbamate |
| SMILES | O=C(NC1CCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c14-12(13-10-6-4-5-7-10)15-11-8-2-1-3-9-11/h1-3,8-10H,4-7H2,(H,13,14) |
| InChIKey | QQUHFUIRBALNSV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl N-cyclopentylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-cyclopentylcarbamate?
The IUPAC name of phenyl N-cyclopentylcarbamate (CID 12791466) is phenyl N-cyclopentylcarbamate.
What is the SMILES notation for phenyl N-cyclopentylcarbamate?
The canonical SMILES for phenyl N-cyclopentylcarbamate is O=C(NC1CCCC1)Oc1ccccc1.
What is the InChIKey of phenyl N-cyclopentylcarbamate?
The InChIKey is QQUHFUIRBALNSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(13-10-6-4-5-7-10)15-11-8-2-1-3-9-11/h1-3,8-10H,4-7H2,(H,13,14).
What are the key properties of phenyl N-cyclopentylcarbamate?
phenyl N-cyclopentylcarbamate has a molecular weight of 205.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-cyclopentylcarbamate is sourced from PubChem (CID 12791466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).