C20H24ClN3O2 — CID 56679465
ethyl N-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]carbamate (PubChem CID 56679465) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is ethyl N-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 56679465 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl N-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]carbamate |
| SMILES | CCOC(=O)NC1CCN(C(c2ccc(Cl)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-2-26-20(25)23-18-9-12-24(13-10-18)19(16-4-3-11-22-14-16)15-5-7-17(21)8-6-15/h3-8,11,14,18-19H,2,9-10,12-13H2,1H3,(H,23,25) |
| InChIKey | SZOPYPRIVNHWPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |