C24H24Cl2N4O — CID 56676121
1-(4-chlorophenyl)-3-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]urea (PubChem CID 56676121) has the molecular formula C24H24Cl2N4O and a molecular weight of 455.39 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 56676121 |
| Molecular Formula | C24H24Cl2N4O |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-[(4-chlorophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCN(C(c2ccc(Cl)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C24H24Cl2N4O/c25-19-5-3-17(4-6-19)23(18-2-1-13-27-16-18)30-14-11-22(12-15-30)29-24(31)28-21-9-7-20(26)8-10-21/h1-10,13,16,22-23H,11-12,14-15H2,(H2,28,29,31) |
| InChIKey | WVGOTLCESRPVGW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |