C21H26N2O2 — CID 5009193
1-[(4-propan-2-ylphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 5009193) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-propan-2-ylphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5009193 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(4-propan-2-ylphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(C(c2cccnc2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-15(2)16-7-9-17(10-8-16)20(18-5-3-11-22-13-18)23-12-4-6-19(14-23)21(24)25/h3,5,7-11,13,15,19-20H,4,6,12,14H2,1-2H3,(H,24,25) |
| InChIKey | MYUXZZHRYQNNDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |