C19H21FN2O3 — CID 3942168
1-[(5-fluoro-2-methoxyphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 3942168) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methoxyphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-fluoro-2-methoxyphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3942168 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[(5-fluoro-2-methoxyphenyl)-pyridin-3-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(F)cc1C(c1cccnc1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C19H21FN2O3/c1-25-17-7-6-15(20)10-16(17)18(13-4-2-8-21-11-13)22-9-3-5-14(12-22)19(23)24/h2,4,6-8,10-11,14,18H,3,5,9,12H2,1H3,(H,23,24) |
| InChIKey | HDPSXLBNVVMUKM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |