C18H19ClFNO3S — CID 4684788
1-[(5-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 4684788) has the molecular formula C18H19ClFNO3S and a molecular weight of 383.87 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4684788 |
| Molecular Formula | C18H19ClFNO3S |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(F)cc1C(c1ccc(Cl)s1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C18H19ClFNO3S/c1-24-14-5-4-12(20)9-13(14)17(15-6-7-16(19)25-15)21-8-2-3-11(10-21)18(22)23/h4-7,9,11,17H,2-3,8,10H2,1H3,(H,22,23) |
| InChIKey | SNFSULUSYHTXEX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |