C17H20ClNO2S2 — CID 5202248
1-[(5-chlorothiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 5202248) has the molecular formula C17H20ClNO2S2 and a molecular weight of 369.94 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5202248 |
| Molecular Formula | C17H20ClNO2S2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCc1ccc(C(c2ccc(Cl)s2)N2CCCC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C17H20ClNO2S2/c1-2-12-5-6-13(22-12)16(14-7-8-15(18)23-14)19-9-3-4-11(10-19)17(20)21/h5-8,11,16H,2-4,9-10H2,1H3,(H,20,21) |
| InChIKey | SEAUDRQIRYQCGJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |