C23H25NO2S — CID 4213640
1-[(5-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4213640) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4213640 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | CCc1ccc(C(c2ccc3ccccc3c2)N2CCCC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C23H25NO2S/c1-2-20-11-12-21(27-20)22(24-13-5-8-19(15-24)23(25)26)18-10-9-16-6-3-4-7-17(16)14-18/h3-4,6-7,9-12,14,19,22H,2,5,8,13,15H2,1H3,(H,25,26) |
| InChIKey | ABEJPGHBRNGQNI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |