C23H25NO3S — CID 5032514
1-[1-benzothiophen-2-yl-(4-ethoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 5032514) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl-(4-ethoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-2-yl-(4-ethoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5032514 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[1-benzothiophen-2-yl-(4-ethoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(C(c2cc3ccccc3s2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-2-27-19-11-9-16(10-12-19)22(24-13-5-7-18(15-24)23(25)26)21-14-17-6-3-4-8-20(17)28-21/h3-4,6,8-12,14,18,22H,2,5,7,13,15H2,1H3,(H,25,26) |
| InChIKey | SCSKXBJXOAPFNL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |