C28H27NO3S — CID 4210181
1-[1-benzothiophen-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 4210181) has the molecular formula C28H27NO3S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4210181 |
| Molecular Formula | C28H27NO3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-[1-benzothiophen-2-yl-(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2ccc(OCc3ccccc3)cc2)c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C28H27NO3S/c30-28(31)23-10-6-16-29(18-23)27(26-17-22-9-4-5-11-25(22)33-26)21-12-14-24(15-13-21)32-19-20-7-2-1-3-8-20/h1-5,7-9,11-15,17,23,27H,6,10,16,18-19H2,(H,30,31) |
| InChIKey | ZYNDFKCBAMAWHP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |