C18H20ClNO2S — CID 4316282
1-[(5-chlorothiophen-2-yl)-(4-methylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 4316282) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)-(4-methylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)-(4-methylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4316282 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)-(4-methylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(c2ccc(Cl)s2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C18H20ClNO2S/c1-12-4-6-13(7-5-12)17(15-8-9-16(19)23-15)20-10-2-3-14(11-20)18(21)22/h4-9,14,17H,2-3,10-11H2,1H3,(H,21,22) |
| InChIKey | IUSSMUWXALHUCC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |