C19H23NO2S2 — CID 3465094
1-[(4-methylsulfanylphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 3465094) has the molecular formula C19H23NO2S2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-methylsulfanylphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3465094 |
| Molecular Formula | C19H23NO2S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CSc1ccc(C(c2cc(C)cs2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H23NO2S2/c1-13-10-17(24-12-13)18(14-5-7-16(23-2)8-6-14)20-9-3-4-15(11-20)19(21)22/h5-8,10,12,15,18H,3-4,9,11H2,1-2H3,(H,21,22) |
| InChIKey | NYCOFXKRPULWPJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |