C19H22N2O2S — CID 4271286
1-[(4-methylsulfanylphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4271286) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-methylsulfanylphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4271286 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | CSc1ccc(C(c2ccccn2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-24-16-9-7-14(8-10-16)18(17-6-2-3-11-20-17)21-12-4-5-15(13-21)19(22)23/h2-3,6-11,15,18H,4-5,12-13H2,1H3,(H,22,23) |
| InChIKey | NBJQLWHRESTIJV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |