C18H20BrNO2S2 — CID 3915873
1-[(5-bromothiophen-2-yl)-(4-methylsulfanylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3915873) has the molecular formula C18H20BrNO2S2 and a molecular weight of 426.40 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(4-methylsulfanylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(4-methylsulfanylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3915873 |
| Molecular Formula | C18H20BrNO2S2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(4-methylsulfanylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | CSc1ccc(C(c2ccc(Br)s2)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C18H20BrNO2S2/c1-23-14-6-4-12(5-7-14)17(15-8-9-16(19)24-15)20-10-2-3-13(11-20)18(21)22/h4-9,13,17H,2-3,10-11H2,1H3,(H,21,22) |
| InChIKey | IFOZRIILBDRBKY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |