C17H17BrClNO2S — CID 4043746
1-[(5-bromothiophen-2-yl)-(4-chlorophenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 4043746) has the molecular formula C17H17BrClNO2S and a molecular weight of 414.75 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(4-chlorophenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(4-chlorophenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4043746 |
| Molecular Formula | C17H17BrClNO2S |
| Molecular Weight | 414.75 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(4-chlorophenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2ccc(Cl)cc2)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C17H17BrClNO2S/c18-15-6-5-14(23-15)16(11-1-3-13(19)4-2-11)20-9-7-12(8-10-20)17(21)22/h1-6,12,16H,7-10H2,(H,21,22) |
| InChIKey | NOAFZVOCTKLXKY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.75 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |