C16H17ClN2O2S — CID 5003314
1-[(5-chlorothiophen-2-yl)-pyridin-3-ylmethyl]piperidine-4-carboxylic acid (PubChem CID 5003314) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)-pyridin-3-ylmethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)-pyridin-3-ylmethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5003314 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)-pyridin-3-ylmethyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2cccnc2)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H17ClN2O2S/c17-14-4-3-13(22-14)15(12-2-1-7-18-10-12)19-8-5-11(6-9-19)16(20)21/h1-4,7,10-11,15H,5-6,8-9H2,(H,20,21) |
| InChIKey | YYSDVWAVRJEUDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |