C18H17BrF3NO2S — CID 4265810
1-[(5-bromothiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 4265810) has the molecular formula C18H17BrF3NO2S and a molecular weight of 448.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4265810 |
| Molecular Formula | C18H17BrF3NO2S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2cccc(C(F)(F)F)c2)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C18H17BrF3NO2S/c19-15-5-4-14(26-15)16(23-8-6-11(7-9-23)17(24)25)12-2-1-3-13(10-12)18(20,21)22/h1-5,10-11,16H,6-9H2,(H,24,25) |
| InChIKey | SYHRZCQRLFHHTL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |