C18H18F3NO2S — CID 3553835
1-[thiophen-2-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 3553835) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-[thiophen-2-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[thiophen-2-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3553835 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-[thiophen-2-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2cccc(C(F)(F)F)c2)c2cccs2)CC1 |
| InChI | InChI=1S/C18H18F3NO2S/c19-18(20,21)14-4-1-3-13(11-14)16(15-5-2-10-25-15)22-8-6-12(7-9-22)17(23)24/h1-5,10-12,16H,6-9H2,(H,23,24) |
| InChIKey | APUHLOCFJNZCEB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |