C22H22FNO3S — CID 5204411
1-[1-benzothiophen-3-yl-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 5204411) has the molecular formula C22H22FNO3S and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[1-benzothiophen-3-yl-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-3-yl-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5204411 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[1-benzothiophen-3-yl-(5-fluoro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(F)cc1C(c1csc2ccccc12)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C22H22FNO3S/c1-27-19-9-8-15(23)11-17(19)21(24-10-4-5-14(12-24)22(25)26)18-13-28-20-7-3-2-6-16(18)20/h2-3,6-9,11,13-14,21H,4-5,10,12H2,1H3,(H,25,26) |
| InChIKey | MPONFRZADZPIEW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |