C18H18Cl2N2O2 — CID 3452120
1-[(3,4-dichlorophenyl)-pyridin-4-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 3452120) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)-pyridin-4-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)-pyridin-4-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3452120 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)-pyridin-4-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2ccncc2)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-15-4-3-13(10-16(15)20)17(12-5-7-21-8-6-12)22-9-1-2-14(11-22)18(23)24/h3-8,10,14,17H,1-2,9,11H2,(H,23,24) |
| InChIKey | RSGDYMPOKIKLCG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |