C22H20Cl2N2O2 — CID 3915876
1-[(3,4-dichlorophenyl)-quinolin-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 3915876) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)-quinolin-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)-quinolin-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3915876 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)-quinolin-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2ccc(Cl)c(Cl)c2)c2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C22H20Cl2N2O2/c23-17-9-7-15(12-18(17)24)21(26-11-3-5-16(13-26)22(27)28)20-10-8-14-4-1-2-6-19(14)25-20/h1-2,4,6-10,12,16,21H,3,5,11,13H2,(H,27,28) |
| InChIKey | WLSGJGKHWNPMKI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |