C23H21F3N2O2 — CID 3681831
1-[quinolin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 3681831) has the molecular formula C23H21F3N2O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-[quinolin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[quinolin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3681831 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[quinolin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2ccc(C(F)(F)F)cc2)c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H21F3N2O2/c24-23(25,26)18-8-5-16(6-9-18)21(28-13-11-17(12-14-28)22(29)30)20-10-7-15-3-1-2-4-19(15)27-20/h1-10,17,21H,11-14H2,(H,29,30) |
| InChIKey | JWAOQZRTMAKIIR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |