C25H28N2O5 — CID 3995629
1-[quinolin-2-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 3995629) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[quinolin-2-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[quinolin-2-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3995629 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-[quinolin-2-yl-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(C(c2ccc3ccccc3n2)N2CCC(C(=O)O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N2O5/c1-30-21-14-18(15-22(31-2)24(21)32-3)23(27-12-10-17(11-13-27)25(28)29)20-9-8-16-6-4-5-7-19(16)26-20/h4-9,14-15,17,23H,10-13H2,1-3H3,(H,28,29) |
| InChIKey | IYMYLXPNQIEPNZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |