C17H25NO5 — CID 4309568
1-[1-(3,4,5-trimethoxyphenyl)ethyl]piperidine-4-carboxylic acid (PubChem CID 4309568) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[1-(3,4,5-trimethoxyphenyl)ethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-(3,4,5-trimethoxyphenyl)ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4309568 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[1-(3,4,5-trimethoxyphenyl)ethyl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(C(C)N2CCC(C(=O)O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO5/c1-11(18-7-5-12(6-8-18)17(19)20)13-9-14(21-2)16(23-4)15(10-13)22-3/h9-12H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | WECNAWNCPCAKHP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |