C24H23N3OS — CID 56532971
(1-benzylindol-3-yl)-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone (PubChem CID 56532971) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is (1-benzylindol-3-yl)-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (1-benzylindol-3-yl)-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56532971 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (1-benzylindol-3-yl)-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)c2ccccc12)N1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C24H23N3OS/c28-24(26-13-6-9-19(16-26)23-25-12-14-29-23)21-17-27(15-18-7-2-1-3-8-18)22-11-5-4-10-20(21)22/h1-5,7-8,10-12,14,17,19H,6,9,13,15-16H2 |
| InChIKey | MSKVBLDKBIIXLO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |