C20H17N3O2 — CID 122187131
ethyl 9-(pyridin-2-ylmethyl)pyrido[3,4-b]indole-3-carboxylate (PubChem CID 122187131) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is ethyl 9-(pyridin-2-ylmethyl)pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 9-(pyridin-2-ylmethyl)pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 122187131 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | ethyl 9-(pyridin-2-ylmethyl)pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(Cc3ccccn3)c2cn1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-20(24)17-11-16-15-8-3-4-9-18(15)23(19(16)12-22-17)13-14-7-5-6-10-21-14/h3-12H,2,13H2,1H3 |
| InChIKey | MQCXLBWKQYIVHC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |